Products 860693-48-7

CAS 860693-48-7 is the registry number for 2-(Diethylamino)ethyl 4-Amino-3-hydroxybenzoate Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

2-(diethylamino)ethyl 4-amino-3-hydroxybenzoate;hydrochloride (CAS 860693-48-7) is a chemical compound with the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-amino-3-hydroxybenzoate;hydrochloride. InChIKey: HQGDSGMKUSWATA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21ClN2O3
Molecular weight288.77 g/mol
IUPAC name2-(diethylamino)ethyl 4-amino-3-hydroxybenzoate;hydrochloride
InChIKeyHQGDSGMKUSWATA-UHFFFAOYSA-N
SMILESCCN(CC)CCOC(=O)C1=CC(=C(C=C1)N)O.Cl

Computed by PubChem (NCBI)