CAS 158574-87-9 appears in our catalog under these names: 1-Isopropyl-1h-indole-3-carboxylic acid, 95%, 1-Isopropyl-1H-indole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg.
1-propan-2-ylindole-3-carboxylic acid (CAS 158574-87-9) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-propan-2-ylindole-3-carboxylic acid. InChIKey: KJYJJNGAPCAIHG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-propan-2-ylindole-3-carboxylic acid |
| InChIKey | KJYJJNGAPCAIHG-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)