CAS 158599-00-9 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–aminopentanoic acid, Fmoc-Orn-OH 97%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid, 97%, 97%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
(2S)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 158599-00-9) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: ASLOVDWQFVNFRC-SFHVURJKSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | ASLOVDWQFVNFRC-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)