CAS 461691-09-8 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1g, 10g.
(2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 461691-09-8) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: ASLOVDWQFVNFRC-GOSISDBHSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | ASLOVDWQFVNFRC-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)