Products 15861-37-7
CAS 15861-37-7 appears in our catalog under these names: 2,3-Dihydro-1h-indole-6-carboxylic acid hydrochloride, 98%, Indoline-6-carboxylic acid hydrochloride, 97%, Indoline-6-carboxylic acid hydrochloride 98%, Indoline-6-carboxylic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 2.5g.
2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride (CAS 15861-37-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride. InChIKey: GAPSTRMYKHJESC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride |
| InChIKey | GAPSTRMYKHJESC-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)