Products 158619-46-6
CAS 158619-46-6 appears in our catalog under these names: 3'-Methylbiphenyl-3-carboxylic acid, 96%, 3'-Methyl[1,1'-biphenyl]-3-carboxylic acid 98%, 3'-Methyl[1,1'-biphenyl]-3-carboxylic acid, 98%, 98%, 3-(3-Methylphenyl)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
3-(3-methylphenyl)benzoic acid (CAS 158619-46-6) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3-(3-methylphenyl)benzoic acid. InChIKey: BJVLFJADOVATRU-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-(3-methylphenyl)benzoic acid |
| InChIKey | BJVLFJADOVATRU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Methyl-biphenyl-3-carboxylic acid, 3'-methylbiphenyl-3-carboxylic acid, 3-(3-methylphenyl)benzoic acid, 3'-methyl[1,1'-biphenyl]-3-carboxylic acid, CBDivE_005744, [1,1'-Biphenyl]-3-carboxylic acid, 3'-methyl-, 3'-Methyl-3-biphenylcarboxylic acid, 3'-methyl-[1,1'-biphenyl]-3-carboxylic acid, Cambridge id 5211690, 3 inverted exclamation mark -Methylbiphenyl-3-carboxylic Acid