Products 1586700-37-9
CAS 1586700-37-9 is the registry number for 3-(4-Methoxy-3-methylphenyl)-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-methoxy-3-methylphenyl)-1H-pyrazole (CAS 1586700-37-9) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 5-(4-methoxy-3-methylphenyl)-1H-pyrazole. InChIKey: ATWWEQZFMHSSMB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 5-(4-methoxy-3-methylphenyl)-1H-pyrazole |
| InChIKey | ATWWEQZFMHSSMB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=NN2)OC |
Computed by PubChem (NCBI)