CAS 15872-41-0 appears in our catalog under these names: 4-n-Pentyloxybenzoic acid, 98%, 4–Amyloxybenzoic Acid, 4-Amyloxybenzoic Acid, >98.0%(GC)(T), 4-(Pentyloxy)benzoic acid, 98%, 98%, 4-(Pentyloxy)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 10g.
4-pentoxybenzoic acid (CAS 15872-41-0) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 4-pentoxybenzoic acid. InChIKey: OZPPUPJQRJYTNY-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 4-pentoxybenzoic acid |
| InChIKey | OZPPUPJQRJYTNY-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)