CAS 1588440-92-9 appears in our catalog under these names: 2,3-Dimethyl-5-nitro-2h-indazole, 95%, 2,3-Dimethyl-5-nitro-2H-indazole, 97%, 2,3–Dimethyl–5–nitro–2H–indazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
2,3-dimethyl-5-nitroindazole (CAS 1588440-92-9) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2,3-dimethyl-5-nitroindazole. InChIKey: QHLFEOXDVSNQHC-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2,3-dimethyl-5-nitroindazole |
| InChIKey | QHLFEOXDVSNQHC-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NN1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)