CAS 1588508-13-7 is the registry number for (E)-3-(4-Methoxy-2-(trifluoromethyl)phenyl)acrylic acid, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(E)-3-[4-methoxy-2-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 1588508-13-7) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: (E)-3-[4-methoxy-2-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: KIZGTKORCAWIMH-HWKANZROSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | (E)-3-[4-methoxy-2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | KIZGTKORCAWIMH-HWKANZROSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)