CAS 158860-99-2 appears in our catalog under these names: 3-(Cyclopentyloxy)benzoic acid, 98%, 3-(Cyclopentyloxy)benzoic acid, 3-(Cyclopentyloxy)benzoic acid 95%, 3-(Cyclopentyloxy)benzoic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
3-cyclopentyloxybenzoic acid (CAS 158860-99-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 3-cyclopentyloxybenzoic acid. InChIKey: GFTZDGGMZKVKKN-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-cyclopentyloxybenzoic acid |
| InChIKey | GFTZDGGMZKVKKN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)