Products 158861-00-8
CAS 158861-00-8 appears in our catalog under these names: 3-(Cyclohexyloxy)benzoic acid, 3-(Cyclohexyloxy)benzoic acid 98%, 3-(Cyclohexyloxy)benzoic acid, 98%, 98%, 3-(Cyclohexyloxy)benzoic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 50mg, 500mg, 2.5g.
3-cyclohexyloxybenzoic acid (CAS 158861-00-8) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 3-cyclohexyloxybenzoic acid. InChIKey: SEYKRNISPOBNMJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 3-cyclohexyloxybenzoic acid |
| InChIKey | SEYKRNISPOBNMJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)