Products 158878-93-4

CAS 158878-93-4 is the registry number for Methyl 3-azidothiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-azidothiophene-2-carboxylate (CAS 158878-93-4) is a chemical compound with the molecular formula C6H5N3O2S and a molecular weight of 183.19 g/mol. IUPAC name: methyl 3-azidothiophene-2-carboxylate. InChIKey: VAEVGCKRQWDCAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O2S
Molecular weight183.19 g/mol
IUPAC namemethyl 3-azidothiophene-2-carboxylate
InChIKeyVAEVGCKRQWDCAQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CS1)N=[N+]=[N-]

Computed by PubChem (NCBI)