CAS 938-10-3 is the registry number for Phenylsulfonyl azide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
N-diazobenzenesulfonamide (CAS 938-10-3) is a chemical compound with the molecular formula C6H5N3O2S and a molecular weight of 183.19 g/mol. IUPAC name: N-diazobenzenesulfonamide. InChIKey: XMRSVLCCIJUKDQ-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O2S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | N-diazobenzenesulfonamide |
| InChIKey | XMRSVLCCIJUKDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)