Products 2422989-41-9
CAS 2422989-41-9 is the registry number for 1-Amino-3H-1l4-isothiazolo[5,4-b]pyridin-3-one 1-oxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-amino-1-oxo-[1,2]thiazolo[5,4-b]pyridin-3-one (CAS 2422989-41-9) is a chemical compound with the molecular formula C6H5N3O2S and a molecular weight of 183.19 g/mol. IUPAC name: 1-amino-1-oxo-[1,2]thiazolo[5,4-b]pyridin-3-one. InChIKey: OIFIKVGEGYZDMZ-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O2S |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 1-amino-1-oxo-[1,2]thiazolo[5,4-b]pyridin-3-one |
| InChIKey | OIFIKVGEGYZDMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)S(=NC2=O)(=O)N |
Computed by PubChem (NCBI)