CAS 158930-09-7 appears in our catalog under these names: Frovatriptan Succinate, Frovatriptan Succinate, (R)-3-(Methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carboxamide succinate, 98%, 98%, Frovatriptan (succinate), Butanedioic acid, compd. with (3R)-2,3,4,9-tetrahydro-3-(methylamino)-1H-carbazole-6-carboxamide (1:1), ≥97%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 25mg, 50mg, 100mg, 2mg, 5mg, 10mg, 250mg.
Butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (CAS 158930-09-7) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide. InChIKey: WHTHWNUUXINXHN-SBSPUUFOSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| InChIKey | WHTHWNUUXINXHN-SBSPUUFOSA-N |
| SMILES | CN[C@@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)N.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)