CAS 1890250-15-3 is the registry number for 5–fluoro AMB metabolite 6. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2S)-2-[[1-(4-carboxybutyl)indazole-3-carbonyl]amino]-3-methylbutanoic acid (CAS 1890250-15-3) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: (2S)-2-[[1-(4-carboxybutyl)indazole-3-carbonyl]amino]-3-methylbutanoic acid. InChIKey: UFVRQJYBUYNNSH-HNNXBMFYSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | (2S)-2-[[1-(4-carboxybutyl)indazole-3-carbonyl]amino]-3-methylbutanoic acid |
| InChIKey | UFVRQJYBUYNNSH-HNNXBMFYSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CCCCC(=O)O |
Computed by PubChem (NCBI)