CAS 15898-37-0 is the registry number for Sodium 2–methylbenzene–1–sulfinate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 50mg, 500mg, 5g.
Sodium 2-methylbenzenesulfinate (CAS 15898-37-0) is a chemical compound with the molecular formula C7H7NaO2S and a molecular weight of 178.19 g/mol. IUPAC name: sodium 2-methylbenzenesulfinate. InChIKey: KHDBMTLGTSGEEG-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO2S |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | sodium 2-methylbenzenesulfinate |
| InChIKey | KHDBMTLGTSGEEG-UHFFFAOYSA-M |
| SMILES | CC1=CC=CC=C1S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)