CAS 15898-38-1 appears in our catalog under these names: Sodium 3–methylbenzene–1–sulfinate, Sodium 3-methylbenzene-1-sulfinate. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
Sodium 3-methylbenzenesulfinate (CAS 15898-38-1) is a chemical compound with the molecular formula C7H7NaO2S and a molecular weight of 178.19 g/mol. IUPAC name: sodium 3-methylbenzenesulfinate. InChIKey: DAYKJFVIXLSLSS-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO2S |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | sodium 3-methylbenzenesulfinate |
| InChIKey | DAYKJFVIXLSLSS-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)