CAS 51793-64-7 appears in our catalog under these names: Sodium phenylmethanesulfinate, 95%, Sodium phenylmethanesulfinate 95%, Sodium phenylmethanesulfinate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
Sodium phenylmethanesulfinate (CAS 51793-64-7) is a chemical compound with the molecular formula C7H7NaO2S and a molecular weight of 178.19 g/mol. IUPAC name: sodium phenylmethanesulfinate. InChIKey: KQJWHIKPAMMQFZ-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO2S |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | sodium phenylmethanesulfinate |
| InChIKey | KQJWHIKPAMMQFZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CS(=O)[O-].[Na+] |
Computed by PubChem (NCBI)