CAS 15907-81-0 appears in our catalog under these names: Cyclobutanecarboxylic acid (3-chloro-phenyl)-amide, 95%, N-(3-Chlorophenyl)cyclobutanecarboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
N-(3-chlorophenyl)cyclobutanecarboxamide (CAS 15907-81-0) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: N-(3-chlorophenyl)cyclobutanecarboxamide. InChIKey: NKTPEKDVZVAYNU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | N-(3-chlorophenyl)cyclobutanecarboxamide |
| InChIKey | NKTPEKDVZVAYNU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)