Products 159118-65-7
CAS 159118-65-7 appears in our catalog under these names: Octanoic acid-13C4, 99.00%, Octanoic acid-1,2,3,4-13C4, 99 atom % 1. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: 100 mg, 1 g, 500 mg, 250 mg, 1G.
(1,2,3,4-13C4)octanoic acid (CAS 159118-65-7) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 148.18 g/mol. IUPAC name: (1,2,3,4-13C4)octanoic acid. InChIKey: WWZKQHOCKIZLMA-WKHKRNGSSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 148.18 g/mol |
| IUPAC name | (1,2,3,4-13C4)octanoic acid |
| InChIKey | WWZKQHOCKIZLMA-WKHKRNGSSA-N |
| SMILES | CCCC[13CH2][13CH2][13CH2][13C](=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1,2,3,4-~13~C_4_)Octanoic acid, Octanoic acid-13C4, (1,2,3,4-13C4)octanoic acid, Octanoic-1,2,3,4-13c4 acid, Octanoic acid-1,2,3,4-13C4, Caprylic acid-1,2,3,4-13C4, orb3138818, Octanoic acid (1,2,3,4-13C4), Octanoic Acid (1,2,3,4-13C4, 99%), Octanoic acid-1,2,3,4-13C4, 99 atom % 13C, 99% (CP)