Products 64118-36-1
CAS 64118-36-1 appears in our catalog under these names: Octanoic Acid–d2, Octanoic-2,2-d2 Acid, 98 atom % D, min 98% Chemical Purity, Octanoic acid-d2. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 1mg, 1g, 0,5g, 10mg, 100mg, 5mg.
2,2-dideuteriooctanoic acid (CAS 64118-36-1) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 146.22 g/mol. IUPAC name: 2,2-dideuteriooctanoic acid. InChIKey: WWZKQHOCKIZLMA-RJSZUWSASA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 146.22 g/mol |
| IUPAC name | 2,2-dideuteriooctanoic acid |
| InChIKey | WWZKQHOCKIZLMA-RJSZUWSASA-N |
| SMILES | [2H]C([2H])(CCCCCC)C(=O)O |
Computed by PubChem (NCBI)