Products 1592328-59-0
CAS 1592328-59-0 is the registry number for 3-(5-Bromopyridin-3-yl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromo-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1592328-59-0) is a chemical compound with the molecular formula C10H7BrN2O3 and a molecular weight of 283.08 g/mol. IUPAC name: 3-(5-bromo-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: QGYKNKMZODXPNX-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O3 |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 3-(5-bromo-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | QGYKNKMZODXPNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=CN=C2)Br)C(=O)O |
Computed by PubChem (NCBI)