Products 2114236-01-8

CAS 2114236-01-8 is the registry number for 2-(7-Bromo-4-hydroxycinnolin-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(7-bromo-4-oxo-1H-cinnolin-3-yl)acetic acid (CAS 2114236-01-8) is a chemical compound with the molecular formula C10H7BrN2O3 and a molecular weight of 283.08 g/mol. IUPAC name: 2-(7-bromo-4-oxo-1H-cinnolin-3-yl)acetic acid. InChIKey: AFLUOUVEHMEZCI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7BrN2O3
Molecular weight283.08 g/mol
IUPAC name2-(7-bromo-4-oxo-1H-cinnolin-3-yl)acetic acid
InChIKeyAFLUOUVEHMEZCI-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)NN=C(C2=O)CC(=O)O

Computed by PubChem (NCBI)