Products 885518-48-9
CAS 885518-48-9 is the registry number for Methyl 4-bromo-3-formyl-1H-indazole-6-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 4-bromo-3-formyl-2H-indazole-6-carboxylate (CAS 885518-48-9) is a chemical compound with the molecular formula C10H7BrN2O3 and a molecular weight of 283.08 g/mol. IUPAC name: methyl 4-bromo-3-formyl-2H-indazole-6-carboxylate. InChIKey: HZPQUOCOSRXTMS-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O3 |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | methyl 4-bromo-3-formyl-2H-indazole-6-carboxylate |
| InChIKey | HZPQUOCOSRXTMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NNC(=C2C(=C1)Br)C=O |
Computed by PubChem (NCBI)