CAS 15936-13-7 is the registry number for 2-Hydrazineyl-1,8-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,8-naphthyridin-2-ylhydrazine (CAS 15936-13-7) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 1,8-naphthyridin-2-ylhydrazine. InChIKey: NFWVWMMKMUZPSJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 1,8-naphthyridin-2-ylhydrazine |
| InChIKey | NFWVWMMKMUZPSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2)NN |
Computed by PubChem (NCBI)