CAS 1593693-34-5 is the registry number for 4-Chloro-1-methyl-1H-pyrazole-5-sulfonamide, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-1-methylpyrazole-5-sulfonamide (CAS 1593693-34-5) is a chemical compound with the molecular formula C4H6ClN3O2S and a molecular weight of 195.63 g/mol. IUPAC name: 4-chloro-1-methylpyrazole-5-sulfonamide. InChIKey: PIIOELCBZPDVIF-UHFFFAOYSA-N.
| Molecular formula | C4H6ClN3O2S |
|---|---|
| Molecular weight | 195.63 g/mol |
| IUPAC name | 4-chloro-1-methylpyrazole-5-sulfonamide |
| InChIKey | PIIOELCBZPDVIF-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)