CAS 1780688-94-9 appears in our catalog under these names: Dimethyl-1H-1,2,3-triazole-5-sulfonyl chloride, 95%, Dimethyl-1H-1,2,3-triazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,5-dimethyltriazole-4-sulfonyl chloride (CAS 1780688-94-9) is a chemical compound with the molecular formula C4H6ClN3O2S and a molecular weight of 195.63 g/mol. IUPAC name: 3,5-dimethyltriazole-4-sulfonyl chloride. InChIKey: OTMZSAIXJKXVSM-UHFFFAOYSA-N.
| Molecular formula | C4H6ClN3O2S |
|---|---|
| Molecular weight | 195.63 g/mol |
| IUPAC name | 3,5-dimethyltriazole-4-sulfonyl chloride |
| InChIKey | OTMZSAIXJKXVSM-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=N1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)