Products 1780688-94-9

CAS 1780688-94-9 appears in our catalog under these names: Dimethyl-1H-1,2,3-triazole-5-sulfonyl chloride, 95%, Dimethyl-1H-1,2,3-triazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,5-dimethyltriazole-4-sulfonyl chloride (CAS 1780688-94-9) is a chemical compound with the molecular formula C4H6ClN3O2S and a molecular weight of 195.63 g/mol. IUPAC name: 3,5-dimethyltriazole-4-sulfonyl chloride. InChIKey: OTMZSAIXJKXVSM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O2S
Molecular weight195.63 g/mol
IUPAC name3,5-dimethyltriazole-4-sulfonyl chloride
InChIKeyOTMZSAIXJKXVSM-UHFFFAOYSA-N
SMILESCC1=C(N(N=N1)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)