Products 1158781-57-7

CAS 1158781-57-7 is the registry number for 2-(5-Amino-1,3,4-thiadiazol-2-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(5-amino-1,3,4-thiadiazol-2-yl)acetic acid;hydrochloride (CAS 1158781-57-7) is a chemical compound with the molecular formula C4H6ClN3O2S and a molecular weight of 195.63 g/mol. IUPAC name: 2-(5-amino-1,3,4-thiadiazol-2-yl)acetic acid;hydrochloride. InChIKey: WHMMKSMJYCTHBR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O2S
Molecular weight195.63 g/mol
IUPAC name2-(5-amino-1,3,4-thiadiazol-2-yl)acetic acid;hydrochloride
InChIKeyWHMMKSMJYCTHBR-UHFFFAOYSA-N
SMILESC(C1=NN=C(S1)N)C(=O)O.Cl

Computed by PubChem (NCBI)