Products 1393568-12-1

CAS 1393568-12-1 is the registry number for 1-Ethyl-1H-1,2,3-triazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-ethyltriazole-4-sulfonyl chloride (CAS 1393568-12-1) is a chemical compound with the molecular formula C4H6ClN3O2S and a molecular weight of 195.63 g/mol. IUPAC name: 1-ethyltriazole-4-sulfonyl chloride. InChIKey: BVELZTNYGZTNOI-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O2S
Molecular weight195.63 g/mol
IUPAC name1-ethyltriazole-4-sulfonyl chloride
InChIKeyBVELZTNYGZTNOI-UHFFFAOYSA-N
SMILESCCN1C=C(N=N1)S(=O)(=O)Cl

Computed by PubChem (NCBI)