CAS 159382-23-7 is the registry number for 4,6-Diaminoquinazoline. Offered by: TRC. Available pack sizes: 10g.
Quinazoline-4,6-diamine (CAS 159382-23-7) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: quinazoline-4,6-diamine. InChIKey: RNWDENXDCQXZLH-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | quinazoline-4,6-diamine |
| InChIKey | RNWDENXDCQXZLH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=NC=N2)N |
Computed by PubChem (NCBI)