Products 159420-85-6
CAS 159420-85-6 is the registry number for 2',4,4',5,5',6-Hexachloro-(1,1'-biphenyl)-2-ol. Offered by: TRC. Available pack sizes: 100mg.
3,4,5-trichloro-2-(2,4,5-trichlorophenyl)phenol (CAS 159420-85-6) is a chemical compound with the molecular formula C12H4Cl6O and a molecular weight of 376.9 g/mol. IUPAC name: 3,4,5-trichloro-2-(2,4,5-trichlorophenyl)phenol. InChIKey: DUYUNNFIHOWGAB-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6O |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 3,4,5-trichloro-2-(2,4,5-trichlorophenyl)phenol |
| InChIKey | DUYUNNFIHOWGAB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C2=C(C(=C(C=C2O)Cl)Cl)Cl |
Computed by PubChem (NCBI)