CAS 54284-55-8 is the registry number for 2,2',4,4',5,5'-Hexachloro-3-biphenylol. Offered by: TRC. Available pack sizes: 100mg.
2,3,6-trichloro-5-(2,4,5-trichlorophenyl)phenol (CAS 54284-55-8) is a chemical compound with the molecular formula C12H4Cl6O and a molecular weight of 376.9 g/mol. IUPAC name: 2,3,6-trichloro-5-(2,4,5-trichlorophenyl)phenol. InChIKey: ZVJPNYXNOYRCIJ-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6O |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 2,3,6-trichloro-5-(2,4,5-trichlorophenyl)phenol |
| InChIKey | ZVJPNYXNOYRCIJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C2=CC(=C(C(=C2Cl)O)Cl)Cl |
Computed by PubChem (NCBI)