Products 71585-39-2
CAS 71585-39-2 is the registry number for 2,2',3,3',4,4'-Hexachlorodiphenyl Ether. Offered by: TRC. Available pack sizes: 250mg.
1,2,3-trichloro-4-(2,3,4-trichlorophenoxy)benzene (CAS 71585-39-2) is a chemical compound with the molecular formula C12H4Cl6O and a molecular weight of 376.9 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,3,4-trichlorophenoxy)benzene. InChIKey: ATIMVMORQPKRPC-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6O |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,3,4-trichlorophenoxy)benzene |
| InChIKey | ATIMVMORQPKRPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC2=C(C(=C(C=C2)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Hexachlorodiphenyloxide, Phenyl ether, hexachloro deriv., Ether, hexachlorophenyl, Hexachlorodiphenyl oxide, Trichloro diphenyl ether, Trichloro diphenyl oxide, Hexachloro diphenyl oxide, 1,1'-Oxybisbenzene hexachloro deriv., Benzene, 1,1'-oxybis-, hexachloro deriv., ETHER, TRICHLOROPHENYL