Products 1594567-57-3
CAS 1594567-57-3 is the registry number for 1-(3-chloro-4-methylphenyl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chloro-4-methylphenyl)-2,2-dimethylpropan-1-ol (CAS 1594567-57-3) is a chemical compound with the molecular formula C12H17ClO and a molecular weight of 212.71 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-2,2-dimethylpropan-1-ol. InChIKey: QVPMTXXNBRRVIA-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO |
|---|---|
| Molecular weight | 212.71 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | QVPMTXXNBRRVIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C(C)(C)C)O)Cl |
Computed by PubChem (NCBI)