CAS 159471-46-2 is the registry number for 5-Hydroxy-PhIP. Offered by: TRC. Available pack sizes: 25mg.
2-amino-1-methyl-6-phenyl-4H-imidazo[4,5-b]pyridin-5-one (CAS 159471-46-2) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 2-amino-1-methyl-6-phenyl-4H-imidazo[4,5-b]pyridin-5-one. InChIKey: VFOYOLOUKGRSJB-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 2-amino-1-methyl-6-phenyl-4H-imidazo[4,5-b]pyridin-5-one |
| InChIKey | VFOYOLOUKGRSJB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC(=O)C(=C2)C3=CC=CC=C3)N=C1N |
Computed by PubChem (NCBI)