Products 1594751-17-3
CAS 1594751-17-3 is the registry number for N-Cyclopropyl-5-(pyrrolidin-2-yl)-1,2,4-oxadiazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide (CAS 1594751-17-3) is a chemical compound with the molecular formula C10H14N4O2 and a molecular weight of 222.24 g/mol. IUPAC name: N-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide. InChIKey: ZLDUQTODRFVSOS-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide |
| InChIKey | ZLDUQTODRFVSOS-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC(=NO2)C(=O)NC3CC3 |
Computed by PubChem (NCBI)