CAS 1595161-28-6 is the registry number for N-(2-Aminoethyl)-3,4-dimethoxybenzenesulfonamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-aminoethyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride (CAS 1595161-28-6) is a chemical compound with the molecular formula C10H17ClN2O4S and a molecular weight of 296.77 g/mol. IUPAC name: N-(2-aminoethyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride. InChIKey: NQBWFDAXYVAHEQ-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O4S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | N-(2-aminoethyl)-3,4-dimethoxybenzenesulfonamide;hydrochloride |
| InChIKey | NQBWFDAXYVAHEQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)NCCN)OC.Cl |
Computed by PubChem (NCBI)