CAS 2855959-37-2 is the registry number for tert-Butyl 6-(chlorosulfonyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chlorosulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxylate (CAS 2855959-37-2) is a chemical compound with the molecular formula C10H17ClN2O4S and a molecular weight of 296.77 g/mol. IUPAC name: tert-butyl 2-chlorosulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxylate. InChIKey: FOXUAIPOOGOSHC-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O4S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | tert-butyl 2-chlorosulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxylate |
| InChIKey | FOXUAIPOOGOSHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)