CAS 86225-64-1 is the registry number for 3-Hydroxy-3-(4’-methoxy-3’-sulfonamidophenyl)-2-propylamine, Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
5-(2-amino-1-hydroxypropyl)-2-methoxybenzenesulfonamide;hydrochloride (CAS 86225-64-1) is a chemical compound with the molecular formula C10H17ClN2O4S and a molecular weight of 296.77 g/mol. IUPAC name: 5-(2-amino-1-hydroxypropyl)-2-methoxybenzenesulfonamide;hydrochloride. InChIKey: VICABCXTWWFCTN-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O4S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 5-(2-amino-1-hydroxypropyl)-2-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | VICABCXTWWFCTN-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC(=C(C=C1)OC)S(=O)(=O)N)O)N.Cl |
Computed by PubChem (NCBI)