CAS 159573-88-3 is the registry number for (2R,5R,6R)-6-Amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 159573-88-3) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: (2R,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: NGHVIOIJCVXTGV-ZMIZWQJLSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | (2R,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | NGHVIOIJCVXTGV-ZMIZWQJLSA-N |
| SMILES | CC1([C@H](N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)C |
Computed by PubChem (NCBI)