CAS 15961-35-0 is the registry number for 4,4,6-Trimethyl-2-phenyl-1,3,2-dioxaborinane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4,4,6-trimethyl-2-phenyl-1,3,2-dioxaborinane (CAS 15961-35-0) is a chemical compound with the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. IUPAC name: 4,4,6-trimethyl-2-phenyl-1,3,2-dioxaborinane. InChIKey: QTHVGJPLXHEIAZ-UHFFFAOYSA-N.
| Molecular formula | C12H17BO2 |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 4,4,6-trimethyl-2-phenyl-1,3,2-dioxaborinane |
| InChIKey | QTHVGJPLXHEIAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)