Products 2225176-74-7
CAS 2225176-74-7 is the registry number for 3–Cyclopropyl–5–(iso–propyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-cyclopropyl-5-propan-2-ylphenyl)boronic acid (CAS 2225176-74-7) is a chemical compound with the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. IUPAC name: (3-cyclopropyl-5-propan-2-ylphenyl)boronic acid. InChIKey: OHXBJHPJNVHCTC-UHFFFAOYSA-N.
| Molecular formula | C12H17BO2 |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | (3-cyclopropyl-5-propan-2-ylphenyl)boronic acid |
| InChIKey | OHXBJHPJNVHCTC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)C)C2CC2)(O)O |
Computed by PubChem (NCBI)