CAS 1596958-21-2 is the registry number for 1-(2,6-Difluoro-benzyl)-1h-pyrazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(2,6-difluorophenyl)methyl]pyrazol-4-ol (CAS 1596958-21-2) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)methyl]pyrazol-4-ol. InChIKey: DCDUXUJUEIOIRD-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1-[(2,6-difluorophenyl)methyl]pyrazol-4-ol |
| InChIKey | DCDUXUJUEIOIRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN2C=C(C=N2)O)F |
Computed by PubChem (NCBI)