Products 2300114-91-2
CAS 2300114-91-2 is the registry number for 2-(3,5-Difluorophenyl)-5-methyl-2,4-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3,5-difluorophenyl)-5-methyl-4H-pyrazol-3-one (CAS 2300114-91-2) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-5-methyl-4H-pyrazol-3-one. InChIKey: YHEZOJUWURDANX-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-5-methyl-4H-pyrazol-3-one |
| InChIKey | YHEZOJUWURDANX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)