CAS 2090126-50-2 is the registry number for (2-(2,4-Difluorophenyl)-1H-imidazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,4-difluorophenyl)-1H-imidazol-5-yl]methanol (CAS 2090126-50-2) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: [2-(2,4-difluorophenyl)-1H-imidazol-5-yl]methanol. InChIKey: AQKDJFNFLCGVPP-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | [2-(2,4-difluorophenyl)-1H-imidazol-5-yl]methanol |
| InChIKey | AQKDJFNFLCGVPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NC=C(N2)CO |
Computed by PubChem (NCBI)