Products 1597440-03-3
CAS 1597440-03-3 appears in our catalog under these names: (Rac)-BRD0705, (Rac)–BRD0705, BRD 0705, (Rac)-BRD0705, 99.17%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), Get quote.
4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (CAS 1597440-03-3) is a chemical compound with the molecular formula C20H23N3O and a molecular weight of 321.4 g/mol. IUPAC name: 4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one. InChIKey: NCKLQXXBRWCYMA-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| InChIKey | NCKLQXXBRWCYMA-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(NC3=C1C(=O)CC(C3)(C)C)NN=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)