Products 1598357-06-2

CAS 1598357-06-2 is the registry number for 2-((Phenylmethoxy)methyl)butanoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

2-(phenylmethoxymethyl)butanoic acid (CAS 1598357-06-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-(phenylmethoxymethyl)butanoic acid. InChIKey: SVTBTHXQNBOQBT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name2-(phenylmethoxymethyl)butanoic acid
InChIKeySVTBTHXQNBOQBT-UHFFFAOYSA-N
SMILESCCC(COCC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)