Products 159847-71-9
CAS 159847-71-9 appears in our catalog under these names: 3-Amino-4-cyanobenzoic acid, 97%, 3–Amino–4–cyanobenzoic acid, 3-Amino-4-cyanobenzoic acid 97%, 3-Amino-4-cyanobenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 10g, 100mg.
3-amino-4-cyanobenzoic acid (CAS 159847-71-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 3-amino-4-cyanobenzoic acid. InChIKey: VEDDRDQNFWIJHM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-amino-4-cyanobenzoic acid |
| InChIKey | VEDDRDQNFWIJHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)C#N |
Computed by PubChem (NCBI)